About [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol
[(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol (PubChem CID 134969713) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol.
Molecular Properties
| Compound Name | [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol |
| PubChem CID | 134969713 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol |
| SMILES | C[C@@H]1O[C@H](CO)C1CO |
| InChI | InChI=1S/C6H12O3/c1-4-5(2-7)6(3-8)9-4/h4-8H,2-3H2,1H3/t4-,5?,6+/m0/s1 |
| InChIKey | VJPPCXSOXBVDKY-NOWQFEBASA-N |
| XLogP | -0.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol?
The IUPAC name of [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol (CID 134969713) is [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol.
What is the SMILES notation for [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol?
The canonical SMILES for [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol is C[C@@H]1O[C@H](CO)C1CO.
What is the InChIKey of [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol?
The InChIKey is VJPPCXSOXBVDKY-NOWQFEBASA-N. The full InChI is InChI=1S/C6H12O3/c1-4-5(2-7)6(3-8)9-4/h4-8H,2-3H2,1H3/t4-,5?,6+/m0/s1.
What are the key properties of [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol?
[(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol has a molecular weight of 132.16 g/mol, XLogP of -0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-2-(hydroxymethyl)-4-methyloxetan-3-yl]methanol is sourced from PubChem (CID 134969713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).