C12H19FO — CID 134969762
(6E)-6-(fluoromethylidene)-2,2,3,4,4-pentamethylcyclohexan-1-one (PubChem CID 134969762) has the molecular formula C12H19FO and a molecular weight of 198.28 g/mol. Its IUPAC name is (6E)-6-(fluoromethylidene)-2,2,3,4,4-pentamethylcyclohexan-1-one.
| Compound Name | (6E)-6-(fluoromethylidene)-2,2,3,4,4-pentamethylcyclohexan-1-one |
|---|---|
| PubChem CID | 134969762 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (6E)-6-(fluoromethylidene)-2,2,3,4,4-pentamethylcyclohexan-1-one |
| SMILES | CC1C(C)(C)C/C(=C\F)C(=O)C1(C)C |
| InChI | InChI=1S/C12H19FO/c1-8-11(2,3)6-9(7-13)10(14)12(8,4)5/h7-8H,6H2,1-5H3/b9-7+ |
| InChIKey | RTCTVAUNFJMKMN-VQHVLOKHSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|