C19H38O4Si — CID 134969780
(6R,7S,8R)-6-hydroxy-3,7,9-trimethyl-8-triethylsilyloxydecane-2,4-dione (PubChem CID 134969780) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is (6R,7S,8R)-6-hydroxy-3,7,9-trimethyl-8-triethylsilyloxydecane-2,4-dione.
| Compound Name | (6R,7S,8R)-6-hydroxy-3,7,9-trimethyl-8-triethylsilyloxydecane-2,4-dione |
|---|---|
| PubChem CID | 134969780 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (6R,7S,8R)-6-hydroxy-3,7,9-trimethyl-8-triethylsilyloxydecane-2,4-dione |
| SMILES | CC[Si](CC)(CC)O[C@H](C(C)C)[C@@H](C)[C@H](O)CC(=O)C(C)C(C)=O |
| InChI | InChI=1S/C19H38O4Si/c1-9-24(10-2,11-3)23-19(13(4)5)15(7)18(22)12-17(21)14(6)16(8)20/h13-15,18-19,22H,9-12H2,1-8H3/t14?,15-,18+,19+/m0/s1 |
| InChIKey | MZLYSGCRGRWUNF-RDJWLFASSA-N |
| XLogP | 4.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|