C27H39NO15 — CID 134969788
[(2R,5S)-3,4-diacetyloxy-1-methyl-5-[[(2R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]pyrrolidin-2-yl]methyl acetate (PubChem CID 134969788) has the molecular formula C27H39NO15 and a molecular weight of 617.60 g/mol. Its IUPAC name is [(2R,5S)-3,4-diacetyloxy-1-methyl-5-[[(2R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]pyrrolidin-2-yl]methyl acetate.
| Compound Name | [(2R,5S)-3,4-diacetyloxy-1-methyl-5-[[(2R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]pyrrolidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134969788 |
| Molecular Formula | C27H39NO15 |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | [(2R,5S)-3,4-diacetyloxy-1-methyl-5-[[(2R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]pyrrolidin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](C[C@H]2C(OC(C)=O)C(OC(C)=O)[C@@H](COC(C)=O)N2C)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H39NO15/c1-12(29)36-10-20-24(39-15(4)32)23(38-14(3)31)19(28(20)8)9-21-25(40-16(5)33)27(42-18(7)35)26(41-17(6)34)22(43-21)11-37-13(2)30/h19-27H,9-11H2,1-8H3/t19-,20+,21+,22?,23?,24?,25?,26+,27?/m0/s1 |
| InChIKey | GRXKTOCGHQZVMP-LSSAABHRSA-N |
| XLogP | -0.39 |
| TPSA | 196.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|