C29H37NO6 — CID 134969799
(4R)-4-benzyl-3-[(E,2R,3R,6S,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 134969799) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E,2R,3R,6S,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(E,2R,3R,6S,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134969799 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (4R)-4-benzyl-3-[(E,2R,3R,6S,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(CO[C@@H](C)[C@@H](C)/C=C(\C)[C@H](O)[C@@H](C)C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H37NO6/c1-19(22(4)35-17-24-11-13-26(34-5)14-12-24)15-20(2)27(31)21(3)28(32)30-25(18-36-29(30)33)16-23-9-7-6-8-10-23/h6-15,19,21-22,25,27,31H,16-18H2,1-5H3/b20-15+/t19-,21+,22-,25+,27-/m0/s1 |
| InChIKey | VCZINLGASBKQCC-LXTJBJIHSA-N |
| XLogP | 4.77 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|