C18H36O2Si — CID 134969823
(1R)-1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanol (PubChem CID 134969823) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (1R)-1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanol.
| Compound Name | (1R)-1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanol |
|---|---|
| PubChem CID | 134969823 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (1R)-1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanol |
| SMILES | C[C@@H](O)C1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C18H36O2Si/c1-13(19)14-10-11-15-16(9-8-12-18(14,15)5)20-21(6,7)17(2,3)4/h13-16,19H,8-12H2,1-7H3/t13-,14?,15+,16+,18-/m1/s1 |
| InChIKey | QDFQHDWFYMRCJG-PDZWLATASA-N |
| XLogP | 4.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|