C14H26O8 — CID 134969837
(3R,6S)-2-ethenyl-6-methoxy-3,4,5-tris(methoxymethoxy)oxane (PubChem CID 134969837) has the molecular formula C14H26O8 and a molecular weight of 322.35 g/mol. Its IUPAC name is (3R,6S)-2-ethenyl-6-methoxy-3,4,5-tris(methoxymethoxy)oxane.
| Compound Name | (3R,6S)-2-ethenyl-6-methoxy-3,4,5-tris(methoxymethoxy)oxane |
|---|---|
| PubChem CID | 134969837 |
| Molecular Formula | C14H26O8 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (3R,6S)-2-ethenyl-6-methoxy-3,4,5-tris(methoxymethoxy)oxane |
| SMILES | C=CC1O[C@H](OC)C(OCOC)C(OCOC)[C@@H]1OCOC |
| InChI | InChI=1S/C14H26O8/c1-6-10-11(19-7-15-2)12(20-8-16-3)13(21-9-17-4)14(18-5)22-10/h6,10-14H,1,7-9H2,2-5H3/t10?,11-,12?,13?,14+/m1/s1 |
| InChIKey | TZDUMHGIRWJYSZ-IAPOMNSZSA-N |
| XLogP | 0.51 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|