C18H20N2O2 — CID 134969849
(1S,7R,8R,12S)-4-benzyl-10,10-dimethyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2,5-diene (PubChem CID 134969849) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1S,7R,8R,12S)-4-benzyl-10,10-dimethyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2,5-diene.
| Compound Name | (1S,7R,8R,12S)-4-benzyl-10,10-dimethyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2,5-diene |
|---|---|
| PubChem CID | 134969849 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (1S,7R,8R,12S)-4-benzyl-10,10-dimethyl-9,11-dioxa-3,4-diazatetracyclo[5.5.1.02,6.08,12]trideca-2,5-diene |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H]1C[C@H]2c2nn(Cc3ccccc3)cc21 |
| InChI | InChI=1S/C18H20N2O2/c1-18(2)21-16-12-8-13(17(16)22-18)15-14(12)10-20(19-15)9-11-6-4-3-5-7-11/h3-7,10,12-13,16-17H,8-9H2,1-2H3/t12-,13+,16-,17+/m1/s1 |
| InChIKey | AKFZQEAGLKDSDC-GFOFROLCSA-N |
| XLogP | 3.04 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |