C27H35NO8 — CID 134969915
tert-butyl (4S)-2,2-dimethyl-4-[(2Z)-2-[(4S,5R)-2-oxo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ylidene]ethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 134969915) has the molecular formula C27H35NO8 and a molecular weight of 501.58 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(2Z)-2-[(4S,5R)-2-oxo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ylidene]ethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(2Z)-2-[(4S,5R)-2-oxo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ylidene]ethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 134969915 |
| Molecular Formula | C27H35NO8 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(2Z)-2-[(4S,5R)-2-oxo-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-ylidene]ethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2OC(C)(C)OC2[C@@H]1C/C=C1\C(=O)C2CO[C@H](O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H35NO8/c1-26(2,3)36-25(30)28-13-19-23(35-27(4,5)34-19)18(28)12-11-17-21(29)20-15-32-24(33-20)22(17)31-14-16-9-7-6-8-10-16/h6-11,18-20,22-24H,12-15H2,1-5H3/b17-11+/t18-,19?,20?,22-,23?,24+/m0/s1 |
| InChIKey | HUVDABFEMLZOHR-GPXQKSNISA-N |
| XLogP | 3.35 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|