C16H21NO2 — CID 134970047
methyl (E,2R)-2-amino-2-[(E)-3-phenylprop-2-enyl]hex-4-enoate (PubChem CID 134970047) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is methyl (E,2R)-2-amino-2-[(E)-3-phenylprop-2-enyl]hex-4-enoate.
| Compound Name | methyl (E,2R)-2-amino-2-[(E)-3-phenylprop-2-enyl]hex-4-enoate |
|---|---|
| PubChem CID | 134970047 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | methyl (E,2R)-2-amino-2-[(E)-3-phenylprop-2-enyl]hex-4-enoate |
| SMILES | C/C=C/C[C@@](N)(C/C=C/c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C16H21NO2/c1-3-4-12-16(17,15(18)19-2)13-8-11-14-9-6-5-7-10-14/h3-11H,12-13,17H2,1-2H3/b4-3+,11-8+/t16-/m1/s1 |
| InChIKey | YIGMLDJEYDKKCQ-DNPPOBDSSA-N |
| XLogP | 2.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|