C15H22FNO2 — CID 134970109
4-fluoro-2-[(1S)-1-hydroxyethyl]-N,N-di(propan-2-yl)benzamide (PubChem CID 134970109) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-fluoro-2-[(1S)-1-hydroxyethyl]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-fluoro-2-[(1S)-1-hydroxyethyl]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 134970109 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-fluoro-2-[(1S)-1-hydroxyethyl]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccc(F)cc1[C@H](C)O)C(C)C |
| InChI | InChI=1S/C15H22FNO2/c1-9(2)17(10(3)4)15(19)13-7-6-12(16)8-14(13)11(5)18/h6-11,18H,1-5H3/t11-/m0/s1 |
| InChIKey | XKYBKEJVWQMNGB-NSHDSACASA-N |
| XLogP | 3.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |