C12H16O2 — CID 134970156
(3R,7S)-pentacyclo[6.4.0.02,10.03,7.09,11]dodecane-3,7-diol (PubChem CID 134970156) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (3R,7S)-pentacyclo[6.4.0.02,10.03,7.09,11]dodecane-3,7-diol.
| Compound Name | (3R,7S)-pentacyclo[6.4.0.02,10.03,7.09,11]dodecane-3,7-diol |
|---|---|
| PubChem CID | 134970156 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (3R,7S)-pentacyclo[6.4.0.02,10.03,7.09,11]dodecane-3,7-diol |
| SMILES | O[C@@]12CCC[C@]1(O)C1C3CC4C(C41)C32 |
| InChI | InChI=1S/C12H16O2/c13-11-2-1-3-12(11,14)10-6-4-5-7(8(5)10)9(6)11/h5-10,13-14H,1-4H2/t5?,6?,7?,8?,9?,10?,11-,12+ |
| InChIKey | HRYVOAQUQYNXQB-YXIGKKBZSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |