C14H21N2O2+ — CID 134970240
1-methyl-3-nitro-5,6,7,8,9,10,11,12-octahydrocyclodeca[b]pyridin-1-ium (PubChem CID 134970240) has the molecular formula C14H21N2O2+ and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-methyl-3-nitro-5,6,7,8,9,10,11,12-octahydrocyclodeca[b]pyridin-1-ium.
| Compound Name | 1-methyl-3-nitro-5,6,7,8,9,10,11,12-octahydrocyclodeca[b]pyridin-1-ium |
|---|---|
| PubChem CID | 134970240 |
| Molecular Formula | C14H21N2O2+ |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-methyl-3-nitro-5,6,7,8,9,10,11,12-octahydrocyclodeca[b]pyridin-1-ium |
| SMILES | C[n+]1cc([N+](=O)[O-])cc2c1CCCCCCCC2 |
| InChI | InChI=1S/C14H21N2O2/c1-15-11-13(16(17)18)10-12-8-6-4-2-3-5-7-9-14(12)15/h10-11H,2-9H2,1H3/q+1 |
| InChIKey | LSEMDVYUWKQMML-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|