C20H20HgN — CID 134970263
[(8S,10R)-17-methyl-10-prop-2-enyl-9-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-8-yl]mercury (PubChem CID 134970263) has the molecular formula C20H20HgN and a molecular weight of 474.98 g/mol. Its IUPAC name is [(8S,10R)-17-methyl-10-prop-2-enyl-9-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-8-yl]mercury.
| Compound Name | [(8S,10R)-17-methyl-10-prop-2-enyl-9-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-8-yl]mercury |
|---|---|
| PubChem CID | 134970263 |
| Molecular Formula | C20H20HgN |
| Molecular Weight | 474.98 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [(8S,10R)-17-methyl-10-prop-2-enyl-9-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-8-yl]mercury |
| SMILES | C=CC[C@@H]1c2ccccc2C2c3ccccc3[C@H]([Hg])N1C2C |
| InChI | InChI=1S/C20H20N.Hg/c1-3-8-19-17-11-6-7-12-18(17)20-14(2)21(19)13-15-9-4-5-10-16(15)20;/h3-7,9-14,19-20H,1,8H2,2H3;/t14?,19-,20?;/m1./s1 |
| InChIKey | NSAPDHUKYDZJID-QAQAMNOKSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|