C19H40O4 — CID 134970307
(3S,5S,7R,9R)-1,11-bis(methoxymethoxy)-3,5,7,9-tetramethylundecane (PubChem CID 134970307) has the molecular formula C19H40O4 and a molecular weight of 332.53 g/mol. Its IUPAC name is (3S,5S,7R,9R)-1,11-bis(methoxymethoxy)-3,5,7,9-tetramethylundecane.
| Compound Name | (3S,5S,7R,9R)-1,11-bis(methoxymethoxy)-3,5,7,9-tetramethylundecane |
|---|---|
| PubChem CID | 134970307 |
| Molecular Formula | C19H40O4 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | (3S,5S,7R,9R)-1,11-bis(methoxymethoxy)-3,5,7,9-tetramethylundecane |
| SMILES | COCOCC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@@H](C)CCOCOC |
| InChI | InChI=1S/C19H40O4/c1-16(7-9-22-14-20-5)11-18(3)13-19(4)12-17(2)8-10-23-15-21-6/h16-19H,7-15H2,1-6H3/t16-,17+,18-,19+ |
| InChIKey | ZHEAHAIXBJDTNE-QGFMHUBQSA-N |
| XLogP | 4.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|