C20H38O4Si — CID 134970369
methyl (2E,5S,6R,7R)-5-hydroxy-6-methyl-7-triethylsilyloxydodeca-2,11-dienoate (PubChem CID 134970369) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is methyl (2E,5S,6R,7R)-5-hydroxy-6-methyl-7-triethylsilyloxydodeca-2,11-dienoate.
| Compound Name | methyl (2E,5S,6R,7R)-5-hydroxy-6-methyl-7-triethylsilyloxydodeca-2,11-dienoate |
|---|---|
| PubChem CID | 134970369 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | methyl (2E,5S,6R,7R)-5-hydroxy-6-methyl-7-triethylsilyloxydodeca-2,11-dienoate |
| SMILES | C=CCCC[C@@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O)C/C=C/C(=O)OC |
| InChI | InChI=1S/C20H38O4Si/c1-7-11-12-15-19(24-25(8-2,9-3)10-4)17(5)18(21)14-13-16-20(22)23-6/h7,13,16-19,21H,1,8-12,14-15H2,2-6H3/b16-13+/t17-,18+,19-/m1/s1 |
| InChIKey | UFMZXZVTVWZENA-BFJJTLHJSA-N |
| XLogP | 4.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|