C19H30NOP — CID 134970393
3-benzyl-2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine (PubChem CID 134970393) has the molecular formula C19H30NOP and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-benzyl-2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine.
| Compound Name | 3-benzyl-2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine |
|---|---|
| PubChem CID | 134970393 |
| Molecular Formula | C19H30NOP |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-benzyl-2-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinine |
| SMILES | CCP1OC2CC(C)CCC2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H30NOP/c1-5-22-20(14-16-9-7-6-8-10-16)19(3,4)17-12-11-15(2)13-18(17)21-22/h6-10,15,17-18H,5,11-14H2,1-4H3 |
| InChIKey | XMXOYUSNLSVYEV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|