C28H42O6S — CID 134970444
methyl (1R,4aR)-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-6-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 134970444) has the molecular formula C28H42O6S and a molecular weight of 506.71 g/mol. Its IUPAC name is methyl (1R,4aR)-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-6-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1R,4aR)-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-6-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 134970444 |
| Molecular Formula | C28H42O6S |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | methyl (1R,4aR)-1,4a-dimethyl-5-(4-methyl-3-oxopentyl)-6-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)C(CCC(=O)C(C)C)C(COS(=O)(=O)c3ccc(C)cc3)CCC21 |
| InChI | InChI=1S/C28H42O6S/c1-19(2)24(29)14-13-23-21(18-34-35(31,32)22-11-8-20(3)9-12-22)10-15-25-27(23,4)16-7-17-28(25,5)26(30)33-6/h8-9,11-12,19,21,23,25H,7,10,13-18H2,1-6H3/t21?,23?,25?,27-,28-/m1/s1 |
| InChIKey | QLLPGVUNBJQUDO-JLWKGIFUSA-N |
| XLogP | 5.72 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|