About methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate
methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate (PubChem CID 134970454) has the molecular formula C22H46O2SiSn
and a molecular weight of 489.41 g/mol. Its IUPAC name is methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate |
| PubChem CID | 134970454 |
| Molecular Formula | C22H46O2SiSn |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@]1(C(=O)OC)C([Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C10H19O2Si.3C4H9.Sn/c1-10(2)7(9(11)12-3)8(10)13(4,5)6;3*1-3-4-2;/h8H,1-6H3;3*1,3-4H2,2H3; |
| InChIKey | IFPWZSZHZMHSDG-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate?
The IUPAC name of methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate (CID 134970454) is methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate?
The canonical SMILES for methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate is CCCC[Sn](CCCC)(CCCC)[C@]1(C(=O)OC)C([Si](C)(C)C)C1(C)C.
What is the InChIKey of methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate?
The InChIKey is IFPWZSZHZMHSDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19O2Si.3C4H9.Sn/c1-10(2)7(9(11)12-3)8(10)13(4,5)6;3*1-3-4-2;/h8H,1-6H3;3*1,3-4H2,2H3;.
What are the key properties of methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate?
methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate has a molecular weight of 489.41 g/mol, XLogP of 7.50, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-2,2-dimethyl-1-tributylstannyl-3-trimethylsilylcyclopropane-1-carboxylate is sourced from PubChem (CID 134970454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).