About [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate
[(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134970478) has the molecular formula C10H15N3O4
and a molecular weight of 241.25 g/mol. Its IUPAC name is [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| PubChem CID | 134970478 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCOC1C=CC(N=[N+]=[N-])[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C10H15N3O4/c1-3-15-10-5-4-8(12-13-11)9(17-10)6-16-7(2)14/h4-5,8-10H,3,6H2,1-2H3/t8?,9-,10?/m1/s1 |
| InChIKey | WIHWYQRBPFVTNM-HWOCKDDLSA-N |
| XLogP | 1.55 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate?
The IUPAC name of [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (CID 134970478) is [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
What is the SMILES notation for [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate?
The canonical SMILES for [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate is CCOC1C=CC(N=[N+]=[N-])[C@@H](COC(C)=O)O1.
What is the InChIKey of [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate?
The InChIKey is WIHWYQRBPFVTNM-HWOCKDDLSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-3-15-10-5-4-8(12-13-11)9(17-10)6-16-7(2)14/h4-5,8-10H,3,6H2,1-2H3/t8?,9-,10?/m1/s1.
What are the key properties of [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate?
[(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate has a molecular weight of 241.25 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-azido-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate is sourced from PubChem (CID 134970478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).