C21H34O4Si — CID 134970525
methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-phenylmethoxypentanoate (PubChem CID 134970525) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-phenylmethoxypentanoate.
| Compound Name | methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 134970525 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-phenylmethoxypentanoate |
| SMILES | C=C[C@@H](C(=O)OC)[C@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O4Si/c1-8-18(20(22)23-5)19(25-26(6,7)21(2,3)4)14-15-24-16-17-12-10-9-11-13-17/h8-13,18-19H,1,14-16H2,2-7H3/t18-,19+/m1/s1 |
| InChIKey | CBMAWGVMJGCUSG-MOPGFXCFSA-N |
| XLogP | 4.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|