About [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol
[(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol (PubChem CID 134970619) has the molecular formula C13H28O3Si
and a molecular weight of 260.45 g/mol. Its IUPAC name is [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol |
| PubChem CID | 134970619 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@@H](C)[C@H](C)[C@@H]1O[C@@H]1CO |
| InChI | InChI=1S/C13H28O3Si/c1-6-17(7-2,8-3)16-11(5)10(4)13-12(9-14)15-13/h10-14H,6-9H2,1-5H3/t10-,11-,12+,13-/m0/s1 |
| InChIKey | WNUHXJUQDGYCBF-RVMXOQNASA-N |
| XLogP | 2.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol?
The IUPAC name of [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol (CID 134970619) is [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol.
What is the SMILES notation for [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol?
The canonical SMILES for [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol is CC[Si](CC)(CC)O[C@@H](C)[C@H](C)[C@@H]1O[C@@H]1CO.
What is the InChIKey of [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol?
The InChIKey is WNUHXJUQDGYCBF-RVMXOQNASA-N. The full InChI is InChI=1S/C13H28O3Si/c1-6-17(7-2,8-3)16-11(5)10(4)13-12(9-14)15-13/h10-14H,6-9H2,1-5H3/t10-,11-,12+,13-/m0/s1.
What are the key properties of [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol?
[(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol has a molecular weight of 260.45 g/mol, XLogP of 2.79, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-3-[(2R,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methanol is sourced from PubChem (CID 134970619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).