C15H24O4 — CID 134970803
(3aR,6S,6aR)-3,3-dimethyl-6-(oxan-2-yloxymethyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one (PubChem CID 134970803) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3aR,6S,6aR)-3,3-dimethyl-6-(oxan-2-yloxymethyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one.
| Compound Name | (3aR,6S,6aR)-3,3-dimethyl-6-(oxan-2-yloxymethyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 134970803 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3aR,6S,6aR)-3,3-dimethyl-6-(oxan-2-yloxymethyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-one |
| SMILES | CC1(C)OC[C@@H]2[C@H]1CC(=O)[C@@H]2COC1CCCCO1 |
| InChI | InChI=1S/C15H24O4/c1-15(2)12-7-13(16)11(10(12)9-19-15)8-18-14-5-3-4-6-17-14/h10-12,14H,3-9H2,1-2H3/t10-,11+,12+,14?/m0/s1 |
| InChIKey | WDSZUYMKQKZWKQ-JVMKAEFSSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |