C13H22O3 — CID 134970929
(1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-prop-1-en-2-ylcyclohex-3-en-1-ol (PubChem CID 134970929) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-prop-1-en-2-ylcyclohex-3-en-1-ol.
| Compound Name | (1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-prop-1-en-2-ylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 134970929 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (1R,2S,5S,6R)-5,6-bis(methoxymethyl)-2-prop-1-en-2-ylcyclohex-3-en-1-ol |
| SMILES | C=C(C)[C@@H]1C=C[C@H](COC)[C@H](COC)[C@@H]1O |
| InChI | InChI=1S/C13H22O3/c1-9(2)11-6-5-10(7-15-3)12(8-16-4)13(11)14/h5-6,10-14H,1,7-8H2,2-4H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | JHJBOQMWCVWKIL-MROQNXINSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|