C22H38OSi2 — CID 134970998
tert-butyl-dimethyl-[7-tri(propan-2-yl)silylhepta-2,4,6-triynoxy]silane (PubChem CID 134970998) has the molecular formula C22H38OSi2 and a molecular weight of 374.72 g/mol. Its IUPAC name is tert-butyl-dimethyl-[7-tri(propan-2-yl)silylhepta-2,4,6-triynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[7-tri(propan-2-yl)silylhepta-2,4,6-triynoxy]silane |
|---|---|
| PubChem CID | 134970998 |
| Molecular Formula | C22H38OSi2 |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | tert-butyl-dimethyl-[7-tri(propan-2-yl)silylhepta-2,4,6-triynoxy]silane |
| SMILES | CC(C)[Si](C#CC#CC#CCO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H38OSi2/c1-19(2)25(20(3)4,21(5)6)18-16-14-12-13-15-17-23-24(10,11)22(7,8)9/h19-21H,17H2,1-11H3 |
| InChIKey | HSKBPTFKEZGSFT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|