About lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine
lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine (PubChem CID 134971008) has the molecular formula C11H16LiN
and a molecular weight of 169.20 g/mol. Its IUPAC name is lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine.
Molecular Properties
| Compound Name | lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine |
| PubChem CID | 134971008 |
| Molecular Formula | C11H16LiN |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine |
| SMILES | CC[C@H](c1[c-]cccc1)N(C)C.[Li+] |
| InChI | InChI=1S/C11H16N.Li/c1-4-11(12(2)3)10-8-6-5-7-9-10;/h5-8,11H,4H2,1-3H3;/q-1;+1/t11-;/m1./s1 |
| InChIKey | NIVRGXDFMJEIRB-RFVHGSKJSA-N |
| XLogP | -0.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine?
The IUPAC name of lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine (CID 134971008) is lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine.
What is the SMILES notation for lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine?
The canonical SMILES for lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine is CC[C@H](c1[c-]cccc1)N(C)C.[Li+].
What is the InChIKey of lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine?
The InChIKey is NIVRGXDFMJEIRB-RFVHGSKJSA-N. The full InChI is InChI=1S/C11H16N.Li/c1-4-11(12(2)3)10-8-6-5-7-9-10;/h5-8,11H,4H2,1-3H3;/q-1;+1/t11-;/m1./s1.
What are the key properties of lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine?
lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine has a molecular weight of 169.20 g/mol, XLogP of -0.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (1R)-N,N-dimethyl-1-phenylpropan-1-amine is sourced from PubChem (CID 134971008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).