About 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one
2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one (PubChem CID 134971090) has the molecular formula C12H21NO2
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one |
| PubChem CID | 134971090 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one |
| SMILES | CC(C)=CC(C)(O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H21NO2/c1-10(2)9-12(3,15)11(14)13-7-5-4-6-8-13/h9,15H,4-8H2,1-3H3 |
| InChIKey | LAVDXFIPTZNTSX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one?
The IUPAC name of 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one (CID 134971090) is 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one.
What is the SMILES notation for 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one?
The canonical SMILES for 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one is CC(C)=CC(C)(O)C(=O)N1CCCCC1.
What is the InChIKey of 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one?
The InChIKey is LAVDXFIPTZNTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-10(2)9-12(3,15)11(14)13-7-5-4-6-8-13/h9,15H,4-8H2,1-3H3.
What are the key properties of 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one?
2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one has a molecular weight of 211.31 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2,4-dimethyl-1-piperidin-1-ylpent-3-en-1-one is sourced from PubChem (CID 134971090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).