C23H31NO3 — CID 134971213
(2S,3S,4R,5S)-5-methyl-4-[[(1R)-1-phenylethyl]amino]-3-phenylmethoxyhept-6-ene-1,2-diol (PubChem CID 134971213) has the molecular formula C23H31NO3 and a molecular weight of 369.50 g/mol. Its IUPAC name is (2S,3S,4R,5S)-5-methyl-4-[[(1R)-1-phenylethyl]amino]-3-phenylmethoxyhept-6-ene-1,2-diol.
| Compound Name | (2S,3S,4R,5S)-5-methyl-4-[[(1R)-1-phenylethyl]amino]-3-phenylmethoxyhept-6-ene-1,2-diol |
|---|---|
| PubChem CID | 134971213 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (2S,3S,4R,5S)-5-methyl-4-[[(1R)-1-phenylethyl]amino]-3-phenylmethoxyhept-6-ene-1,2-diol |
| SMILES | C=C[C@H](C)[C@@H](N[C@H](C)c1ccccc1)[C@H](OCc1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C23H31NO3/c1-4-17(2)22(24-18(3)20-13-9-6-10-14-20)23(21(26)15-25)27-16-19-11-7-5-8-12-19/h4-14,17-18,21-26H,1,15-16H2,2-3H3/t17-,18+,21-,22+,23+/m0/s1 |
| InChIKey | IYKACUXIKUCRTC-UWZAIZGBSA-N |
| XLogP | 3.47 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|