C38H41NO8 — CID 134971222
[(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-[(E)-6-oxododec-2-enyl]oxolan-3-yl]methyl benzoate (PubChem CID 134971222) has the molecular formula C38H41NO8 and a molecular weight of 639.75 g/mol. Its IUPAC name is [(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-[(E)-6-oxododec-2-enyl]oxolan-3-yl]methyl benzoate.
| Compound Name | [(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-[(E)-6-oxododec-2-enyl]oxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 134971222 |
| Molecular Formula | C38H41NO8 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | [(3S,4R,5R)-3-benzamido-4-benzoyloxy-2-oxo-5-[(E)-6-oxododec-2-enyl]oxolan-3-yl]methyl benzoate |
| SMILES | CCCCCCC(=O)CC/C=C/C[C@H]1OC(=O)[C@@](COC(=O)c2ccccc2)(NC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H41NO8/c1-2-3-4-15-24-31(40)25-16-8-17-26-32-33(47-36(43)30-22-13-7-14-23-30)38(37(44)46-32,39-34(41)28-18-9-5-10-19-28)27-45-35(42)29-20-11-6-12-21-29/h5-14,17-23,32-33H,2-4,15-16,24-27H2,1H3,(H,39,41)/b17-8+/t32-,33+,38+/m1/s1 |
| InChIKey | AWVOZRYSPSBXIY-FDJNHJQGSA-N |
| XLogP | 6.43 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|