C22H27F3O7 — CID 134971264
methyl (E,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypent-2-enoate (PubChem CID 134971264) has the molecular formula C22H27F3O7 and a molecular weight of 460.45 g/mol. Its IUPAC name is methyl (E,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypent-2-enoate.
| Compound Name | methyl (E,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypent-2-enoate |
|---|---|
| PubChem CID | 134971264 |
| Molecular Formula | C22H27F3O7 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | methyl (E,4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypent-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](C)[C@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H27F3O7/c1-14(11-12-17(26)28-4)18(16-13-30-20(2,3)32-16)31-19(27)21(29-5,22(23,24)25)15-9-7-6-8-10-15/h6-12,14,16,18H,13H2,1-5H3/b12-11+/t14-,16-,18+,21-/m1/s1 |
| InChIKey | RCMFSSHLISXUNE-WMEVXRSWSA-N |
| XLogP | 3.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|