C19H32O2 — CID 134971318
2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-2-methyl-1,3-dioxolane (PubChem CID 134971318) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134971318 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-2-methyl-1,3-dioxolane |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CC1(C)OCCO1 |
| InChI | InChI=1S/C19H32O2/c1-14-7-8-16-17(2,3)9-6-10-18(16,4)15(14)13-19(5)20-11-12-21-19/h15-16H,1,6-13H2,2-5H3/t15-,16-,18+/m0/s1 |
| InChIKey | ZGAVGENNZUKIDY-XYJFISCASA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|