C28H25NO9 — CID 134971353
[(3S,4R,5R)-3-benzamido-4-benzoyloxy-5-[(1R)-1,2-dihydroxyethyl]-2-oxooxolan-3-yl]methyl benzoate (PubChem CID 134971353) has the molecular formula C28H25NO9 and a molecular weight of 519.51 g/mol. Its IUPAC name is [(3S,4R,5R)-3-benzamido-4-benzoyloxy-5-[(1R)-1,2-dihydroxyethyl]-2-oxooxolan-3-yl]methyl benzoate.
| Compound Name | [(3S,4R,5R)-3-benzamido-4-benzoyloxy-5-[(1R)-1,2-dihydroxyethyl]-2-oxooxolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 134971353 |
| Molecular Formula | C28H25NO9 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [(3S,4R,5R)-3-benzamido-4-benzoyloxy-5-[(1R)-1,2-dihydroxyethyl]-2-oxooxolan-3-yl]methyl benzoate |
| SMILES | O=C(N[C@]1(COC(=O)c2ccccc2)C(=O)O[C@H]([C@H](O)CO)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25NO9/c30-16-21(31)22-23(38-26(34)20-14-8-3-9-15-20)28(27(35)37-22,29-24(32)18-10-4-1-5-11-18)17-36-25(33)19-12-6-2-7-13-19/h1-15,21-23,30-31H,16-17H2,(H,29,32)/t21-,22-,23+,28+/m1/s1 |
| InChIKey | FKMPWTQKXHKPQB-DHMIZTNRSA-N |
| XLogP | 1.52 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|