C21H36O6 — CID 134971402
(1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-2,3,6,6,12-pentamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol (PubChem CID 134971402) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is (1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-2,3,6,6,12-pentamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol.
| Compound Name | (1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-2,3,6,6,12-pentamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol |
|---|---|
| PubChem CID | 134971402 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-2,3,6,6,12-pentamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol |
| SMILES | CC1(C)[C@@H](O)C[C@@]2(C)[C@](C)(O)[C@@H]3CC[C@@H]4[C@H]3[C@](O)(C[C@@H](O)[C@]12O)C[C@@]4(C)O |
| InChI | InChI=1S/C21H36O6/c1-16(2)13(22)8-18(4)19(5,25)12-7-6-11-15(12)20(26,10-17(11,3)24)9-14(23)21(16,18)27/h11-15,22-27H,6-10H2,1-5H3/t11-,12-,13+,14-,15-,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | MBYDKBBXQAQVJR-DOSSQZGDSA-N |
| XLogP | 0.56 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |