About tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane
tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane (PubChem CID 134971449) has the molecular formula C15H32O2Si
and a molecular weight of 272.50 g/mol. Its IUPAC name is tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane |
| PubChem CID | 134971449 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane |
| SMILES | COC=CCC(C)(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O2Si/c1-14(2,3)18(7,8)17-13-11-15(4,5)10-9-12-16-6/h9,12H,10-11,13H2,1-8H3 |
| InChIKey | CMPQRSIYYFPVFM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane?
The IUPAC name of tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane (CID 134971449) is tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane.
What is the SMILES notation for tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane?
The canonical SMILES for tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane is COC=CCC(C)(C)CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane?
The InChIKey is CMPQRSIYYFPVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O2Si/c1-14(2,3)18(7,8)17-13-11-15(4,5)10-9-12-16-6/h9,12H,10-11,13H2,1-8H3.
What are the key properties of tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane?
tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane has a molecular weight of 272.50 g/mol, XLogP of 4.97, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(6-methoxy-3,3-dimethylhex-5-enoxy)-dimethylsilane is sourced from PubChem (CID 134971449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).