C19H29OS+ — CID 134971477
benzyl-[(1S,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium (PubChem CID 134971477) has the molecular formula C19H29OS+ and a molecular weight of 305.51 g/mol. Its IUPAC name is benzyl-[(1S,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium.
| Compound Name | benzyl-[(1S,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium |
|---|---|
| PubChem CID | 134971477 |
| Molecular Formula | C19H29OS+ |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | benzyl-[(1S,3S,4R)-3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-methylsulfanium |
| SMILES | CO[C@@H]1C([S+](C)Cc2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C19H29OS/c1-18(2)15-11-12-19(18,3)17(20-4)16(15)21(5)13-14-9-7-6-8-10-14/h6-10,15-17H,11-13H2,1-5H3/q+1/t15-,16?,17-,19+,21?/m1/s1 |
| InChIKey | ZGNVQNFUBHTKKN-WEDMQCSXSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|