C22H42O6 — CID 134971557
(2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxyundec-10-ene-4,5,7-triol (PubChem CID 134971557) has the molecular formula C22H42O6 and a molecular weight of 402.57 g/mol. Its IUPAC name is (2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxyundec-10-ene-4,5,7-triol.
| Compound Name | (2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxyundec-10-ene-4,5,7-triol |
|---|---|
| PubChem CID | 134971557 |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (2R,3S,4S,5S,7R,9R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,9,10-trimethyl-3-propan-2-yloxyundec-10-ene-4,5,7-triol |
| SMILES | C=C(C)[C@H](C)C[C@@H](O)C[C@H](O)[C@H](O)[C@@H](OC(C)C)[C@H](C)C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H42O6/c1-13(2)15(5)9-17(23)11-19(24)20(25)21(27-14(3)4)16(6)10-18-12-26-22(7,8)28-18/h14-21,23-25H,1,9-12H2,2-8H3/t15-,16-,17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | KYVLIIORRPSAMA-MZNAPKCPSA-N |
| XLogP | 3.03 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|