C23H19F3NO2+ — CID 134971571
benzylidene-phenyl-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]azanium (PubChem CID 134971571) has the molecular formula C23H19F3NO2+ and a molecular weight of 398.40 g/mol. Its IUPAC name is benzylidene-phenyl-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]azanium.
| Compound Name | benzylidene-phenyl-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]azanium |
|---|---|
| PubChem CID | 134971571 |
| Molecular Formula | C23H19F3NO2+ |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | benzylidene-phenyl-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]azanium |
| SMILES | CO[C@](C(=O)/[N+](=C/c1ccccc1)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H19F3NO2/c1-29-22(23(24,25)26,19-13-7-3-8-14-19)21(28)27(20-15-9-4-10-16-20)17-18-11-5-2-6-12-18/h2-17H,1H3/q+1/b27-17+/t22-/m0/s1 |
| InChIKey | UEHFHYZLOJTJQJ-XDQFAZSOSA-N |
| XLogP | 5.08 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|