C50H56O8Si — CID 134971645
(3R,6R)-3-[(2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,6-dihydro-2H-pyran-3-yl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one (PubChem CID 134971645) has the molecular formula C50H56O8Si and a molecular weight of 813.08 g/mol. Its IUPAC name is (3R,6R)-3-[(2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,6-dihydro-2H-pyran-3-yl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one.
| Compound Name | (3R,6R)-3-[(2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,6-dihydro-2H-pyran-3-yl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 134971645 |
| Molecular Formula | C50H56O8Si |
| Molecular Weight | 813.08 g/mol |
| Exact Mass | 812.37 |
| IUPAC Name | (3R,6R)-3-[(2S,3R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,6-dihydro-2H-pyran-3-yl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-one |
| SMILES | CO[C@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@@H]1[C@H]1C(=O)O[C@H](COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C50H56O8Si/c1-50(2,3)59(41-26-16-8-17-27-41,42-28-18-9-19-29-42)56-35-40-30-31-43(49(52-4)57-40)45-47(55-34-39-24-14-7-15-25-39)46(54-33-38-22-12-6-13-23-38)44(58-48(45)51)36-53-32-37-20-10-5-11-21-37/h5-31,40,43-47,49H,32-36H2,1-4H3/t40?,43-,44-,45-,46?,47?,49+/m1/s1 |
| InChIKey | WNGJUENZTAEIKY-PWQZMPJASA-N |
| XLogP | 8.04 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.08 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|