About ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate
ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate (PubChem CID 134971671) has the molecular formula C14H20N3O2+
and a molecular weight of 262.33 g/mol. Its IUPAC name is ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate |
| PubChem CID | 134971671 |
| Molecular Formula | C14H20N3O2+ |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c2cc(N(C)C)ccc2n(C)[n+]1C |
| InChI | InChI=1S/C14H20N3O2/c1-6-19-14(18)13-11-9-10(15(2)3)7-8-12(11)16(4)17(13)5/h7-9H,6H2,1-5H3/q+1 |
| InChIKey | TUQKFAPHYIXMPS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate?
The IUPAC name of ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate (CID 134971671) is ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate.
What is the SMILES notation for ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate?
The canonical SMILES for ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate is CCOC(=O)c1c2cc(N(C)C)ccc2n(C)[n+]1C.
What is the InChIKey of ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate?
The InChIKey is TUQKFAPHYIXMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N3O2/c1-6-19-14(18)13-11-9-10(15(2)3)7-8-12(11)16(4)17(13)5/h7-9H,6H2,1-5H3/q+1.
What are the key properties of ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate?
ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate has a molecular weight of 262.33 g/mol, XLogP of 1.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(dimethylamino)-1,2-dimethylindazol-2-ium-3-carboxylate is sourced from PubChem (CID 134971671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).