C19H22N2O — CID 134971750
(3R,5R)-3,5-diethyl-3,5-diphenyl-4H-pyrazol-4-ol (PubChem CID 134971750) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (3R,5R)-3,5-diethyl-3,5-diphenyl-4H-pyrazol-4-ol.
| Compound Name | (3R,5R)-3,5-diethyl-3,5-diphenyl-4H-pyrazol-4-ol |
|---|---|
| PubChem CID | 134971750 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (3R,5R)-3,5-diethyl-3,5-diphenyl-4H-pyrazol-4-ol |
| SMILES | CC[C@]1(c2ccccc2)N=N[C@](CC)(c2ccccc2)C1O |
| InChI | InChI=1S/C19H22N2O/c1-3-18(15-11-7-5-8-12-15)17(22)19(4-2,21-20-18)16-13-9-6-10-14-16/h5-14,17,22H,3-4H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | SBOUZWULSMVGET-RTBURBONSA-N |
| XLogP | 4.42 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |