C9H16O — CID 134971752
cis-(1R,4R)-2,2,4-trimethyl-5-methylidenecyclopentan-1-ol (PubChem CID 134971752) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is cis-(1R,4R)-2,2,4-trimethyl-5-methylidenecyclopentan-1-ol.
| Compound Name | cis-(1R,4R)-2,2,4-trimethyl-5-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 134971752 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | cis-(1R,4R)-2,2,4-trimethyl-5-methylidenecyclopentan-1-ol |
| SMILES | C=C1[C@H](C)CC(C)(C)[C@H]1O |
| InChI | InChI=1S/C9H16O/c1-6-5-9(3,4)8(10)7(6)2/h6,8,10H,2,5H2,1,3-4H3/t6-,8+/m1/s1 |
| InChIKey | PHPLNOWPDPORHD-SVRRBLITSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|