About 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea
3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea (PubChem CID 134971811) has the molecular formula C10H14ClN3OS2
and a molecular weight of 291.83 g/mol. Its IUPAC name is 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea.
Molecular Properties
| Compound Name | 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea |
| PubChem CID | 134971811 |
| Molecular Formula | C10H14ClN3OS2 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)NNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClN3OS2/c1-3-14(4-2)10(16)13-12-9(15)7-5-6-8(11)17-7/h5-6H,3-4H2,1-2H3,(H,12,15)(H,13,16) |
| InChIKey | VMAPKFQNQGJDFW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea?
The IUPAC name of 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea (CID 134971811) is 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea.
What is the SMILES notation for 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea?
The canonical SMILES for 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea is CCN(CC)C(=S)NNC(=O)c1ccc(Cl)s1.
What is the InChIKey of 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea?
The InChIKey is VMAPKFQNQGJDFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3OS2/c1-3-14(4-2)10(16)13-12-9(15)7-5-6-8(11)17-7/h5-6H,3-4H2,1-2H3,(H,12,15)(H,13,16).
What are the key properties of 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea?
3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea has a molecular weight of 291.83 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chlorothiophene-2-carbonyl)amino]-1,1-diethylthiourea is sourced from PubChem (CID 134971811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).