C17H28O7 — CID 134972221
(6R,9S)-4,4,11,11-tetramethyl-8-[[(2S)-oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 134972221) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is (6R,9S)-4,4,11,11-tetramethyl-8-[[(2S)-oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (6R,9S)-4,4,11,11-tetramethyl-8-[[(2S)-oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 134972221 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (6R,9S)-4,4,11,11-tetramethyl-8-[[(2S)-oxan-2-yl]oxymethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(CO[C@H]3CCCCO3)O[C@@H]2O1 |
| InChI | InChI=1S/C17H28O7/c1-16(2)21-12-10(9-19-11-7-5-6-8-18-11)20-15-14(13(12)22-16)23-17(3,4)24-15/h10-15H,5-9H2,1-4H3/t10?,11-,12-,13?,14?,15+/m0/s1 |
| InChIKey | LGCBXXKHNLORHG-XYAZDCAMSA-N |
| XLogP | 1.93 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |