C34H36NO5+ — CID 134972235
(2S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 134972235) has the molecular formula C34H36NO5+ and a molecular weight of 538.66 g/mol. Its IUPAC name is (2S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | (2S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 134972235 |
| Molecular Formula | C34H36NO5+ |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (2S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | O[N+]1=CC(OCc2ccccc2)C(OCc2ccccc2)[C@@H]1C(COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H36NO5/c36-35-21-31(38-23-28-15-7-2-8-16-28)34(40-25-30-19-11-4-12-20-30)33(35)32(39-24-29-17-9-3-10-18-29)26-37-22-27-13-5-1-6-14-27/h1-21,31-34,36H,22-26H2/q+1/t31?,32?,33-,34?/m0/s1 |
| InChIKey | KPMSMWHHWJISRR-WPHRKSLXSA-N |
| XLogP | 5.81 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|