About 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate
1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate (PubChem CID 134972237) has the molecular formula C22H35O2P
and a molecular weight of 362.49 g/mol. Its IUPAC name is 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate.
Molecular Properties
| Compound Name | 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate |
| PubChem CID | 134972237 |
| Molecular Formula | C22H35O2P |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate |
| SMILES | CCCC[P+](CCCC)(CCCC)C(=C=C([O-])OC)c1ccccc1 |
| InChI | InChI=1S/C22H35O2P/c1-5-8-16-25(17-9-6-2,18-10-7-3)21(19-22(23)24-4)20-14-12-11-13-15-20/h11-15H,5-10,16-18H2,1-4H3 |
| InChIKey | CBBLXECVRLBTLK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate?
The IUPAC name of 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate (CID 134972237) is 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate.
What is the SMILES notation for 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate?
The canonical SMILES for 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate is CCCC[P+](CCCC)(CCCC)C(=C=C([O-])OC)c1ccccc1.
What is the InChIKey of 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate?
The InChIKey is CBBLXECVRLBTLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35O2P/c1-5-8-16-25(17-9-6-2,18-10-7-3)21(19-22(23)24-4)20-14-12-11-13-15-20/h11-15H,5-10,16-18H2,1-4H3.
What are the key properties of 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate?
1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate has a molecular weight of 362.49 g/mol, XLogP of 5.89, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-phenyl-3-tributylphosphaniumylpropa-1,2-dien-1-olate is sourced from PubChem (CID 134972237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).