C29H28Br2N4O6 — CID 134972255
tert-butyl N-[(1R)-1-(1-acetyl-6-bromoindol-3-yl)-2-[[2-(1-acetyl-6-bromoindol-3-yl)-2-oxoacetyl]amino]ethyl]carbamate (PubChem CID 134972255) has the molecular formula C29H28Br2N4O6 and a molecular weight of 688.37 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(1-acetyl-6-bromoindol-3-yl)-2-[[2-(1-acetyl-6-bromoindol-3-yl)-2-oxoacetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(1-acetyl-6-bromoindol-3-yl)-2-[[2-(1-acetyl-6-bromoindol-3-yl)-2-oxoacetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 134972255 |
| Molecular Formula | C29H28Br2N4O6 |
| Molecular Weight | 688.37 g/mol |
| Exact Mass | 686.04 |
| IUPAC Name | tert-butyl N-[(1R)-1-(1-acetyl-6-bromoindol-3-yl)-2-[[2-(1-acetyl-6-bromoindol-3-yl)-2-oxoacetyl]amino]ethyl]carbamate |
| SMILES | CC(=O)n1cc(C(=O)C(=O)NC[C@H](NC(=O)OC(C)(C)C)c2cn(C(C)=O)c3cc(Br)ccc23)c2ccc(Br)cc21 |
| InChI | InChI=1S/C29H28Br2N4O6/c1-15(36)34-13-21(19-8-6-17(30)10-24(19)34)23(33-28(40)41-29(3,4)5)12-32-27(39)26(38)22-14-35(16(2)37)25-11-18(31)7-9-20(22)25/h6-11,13-14,23H,12H2,1-5H3,(H,32,39)(H,33,40)/t23-/m0/s1 |
| InChIKey | XPVXLTWFBXLARK-QHCPKHFHSA-N |
| XLogP | 6.01 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.37 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|