C31H37NO6 — CID 134972297
(2S,3R,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-ol (PubChem CID 134972297) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is (2S,3R,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-ol.
| Compound Name | (2S,3R,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 134972297 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | (2S,3R,4R)-5-(oxan-2-yloxyimino)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
| SMILES | O[C@@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=NOC1CCCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C31H37NO6/c33-28(24-34-21-25-12-4-1-5-13-25)31(37-23-27-16-8-3-9-17-27)29(36-22-26-14-6-2-7-15-26)20-32-38-30-18-10-11-19-35-30/h1-9,12-17,20,28-31,33H,10-11,18-19,21-24H2/t28-,29+,30?,31+/m0/s1 |
| InChIKey | GYUNVHOZJIWIIQ-HBAHIDOBSA-N |
| XLogP | 5.26 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|