C13H26O2Si — CID 134972323
(3S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-yn-3-ol (PubChem CID 134972323) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is (3S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-yn-3-ol.
| Compound Name | (3S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 134972323 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-1-yn-3-ol |
| SMILES | C#C[C@H](O)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-9-11(14)13(5,6)10-15-16(7,8)12(2,3)4/h1,11,14H,10H2,2-8H3/t11-/m0/s1 |
| InChIKey | BOMOSEZFUUVRFD-NSHDSACASA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|