C29H43NO9 — CID 134972332
tert-butyl (4S)-4-[[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134972332) has the molecular formula C29H43NO9 and a molecular weight of 549.66 g/mol. Its IUPAC name is tert-butyl (4S)-4-[[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134972332 |
| Molecular Formula | C29H43NO9 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | tert-butyl (4S)-4-[[(4S,5S)-4-methoxycarbonyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H](OCc1ccc(OC)cc1)[C@@H]1OC(C)(C)O[C@]1(C[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C29H43NO9/c1-11-22(35-17-19-12-14-21(33-9)15-13-19)23-29(24(31)34-10,39-28(7,8)37-23)16-20-18-36-27(5,6)30(20)25(32)38-26(2,3)4/h11-15,20,22-23H,1,16-18H2,2-10H3/t20-,22+,23-,29-/m0/s1 |
| InChIKey | VHWVWNQVCSRZSP-XKKSJELASA-N |
| XLogP | 4.59 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|