C28H41NO8 — CID 134972333
tert-butyl (4S)-4-[[(4S,5S)-4-formyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134972333) has the molecular formula C28H41NO8 and a molecular weight of 519.64 g/mol. Its IUPAC name is tert-butyl (4S)-4-[[(4S,5S)-4-formyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[[(4S,5S)-4-formyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134972333 |
| Molecular Formula | C28H41NO8 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | tert-butyl (4S)-4-[[(4S,5S)-4-formyl-5-[(1R)-1-[(4-methoxyphenyl)methoxy]prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H](OCc1ccc(OC)cc1)[C@@H]1OC(C)(C)O[C@@]1(C=O)C[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H41NO8/c1-10-22(33-16-19-11-13-21(32-9)14-12-19)23-28(18-30,37-27(7,8)35-23)15-20-17-34-26(5,6)29(20)24(31)36-25(2,3)4/h10-14,18,20,22-23H,1,15-17H2,2-9H3/t20-,22+,23-,28+/m0/s1 |
| InChIKey | UELCWOHOJMGYNS-CRQKQFHESA-N |
| XLogP | 4.62 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|